For research use only. Not for therapeutic Use.
2-Cyano-3-methylpyridine 1-oxide(Cat No.:L007190), is a chemical compound with the molecular formula C7H6N2O. It features a pyridine ring—a six-membered heterocyclic structure—substituted with a cyano group at the 2nd position, a methyl group at the 3rd position, and a pyridine 1-oxide moiety. This compound is significant in organic synthesis and medicinal chemistry research. Its unique structure and functional groups make it valuable for creating various derivatives, enabling the development of specialized organic molecules and potential pharmaceuticals. Researchers use 2-cyano-3-methylpyridine 1-oxide as a key intermediate, contributing to advancements in chemical research and drug discovery efforts.
CAS Number | 159727-88-5 |
Molecular Formula | C7H6N2O |
Purity | ≥95% |
IUPAC Name | 3-methyl-1-oxidopyridin-1-ium-2-carbonitrile |
InChI | InChI=1S/C7H6N2O/c1-6-3-2-4-9(10)7(6)5-8/h2-4H,1H3 |
InChIKey | OTXYVTPSEMLVLS-UHFFFAOYSA-N |
SMILES | CC1=C([N+](=CC=C1)[O-])C#N |