For research use only. Not for therapeutic Use.
2-Cyano-4-fluorobenzene-1-sulfonyl chloride(Cat No.:L007232), is a versatile chemical reagent used in organic synthesis and medicinal chemistry research. This compound contains a sulfonyl chloride functional group (-SO2Cl) attached to a fluorinated benzene ring substituted with a cyano group. Sulfonyl chlorides are valuable intermediates in various chemical transformations, including nucleophilic substitution reactions and cross-coupling processes. 2-Cyano-4-fluorobenzene-1-sulfonyl chloride’s reactivity and stability make it useful for designing complex organic molecules, especially in the synthesis of pharmaceuticals and agrochemicals. Researchers utilize this compound to introduce sulfonyl groups, enabling the creation of diverse bioactive molecules and contributing significantly to drug discovery efforts.
CAS Number | 1261674-26-3 |
Molecular Formula | C7H3ClFNO2S |
Purity | ≥95% |
IUPAC Name | 2-cyano-4-fluorobenzenesulfonyl chloride |
InChI | InChI=1S/C7H3ClFNO2S/c8-13(11,12)7-2-1-6(9)3-5(7)4-10/h1-3H |
InChIKey | KXWBPZIFIFCHHG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)C#N)S(=O)(=O)Cl |