For research use only. Not for therapeutic Use.
2-Cyano-4-methylquinoline(Cat No.:M064066)is a heterocyclic compound featuring a cyano group at the 2-position and a methyl group at the 4-position of a quinoline ring. This compound is valuable in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, where it serves as a key intermediate in creating complex molecules. The cyano group provides a reactive site for further chemical transformations, while the methyl group influences the compound’s electronic properties. Its quinoline backbone is crucial for synthesizing bioactive compounds, making it an important building block in medicinal chemistry.
CAS Number | 10590-69-9 |
Molecular Formula | C11H8N2 |
Purity | ≥95% |
IUPAC Name | 4-methylquinoline-2-carbonitrile |
InChI | InChI=1S/C11H8N2/c1-8-6-9(7-12)13-11-5-3-2-4-10(8)11/h2-6H,1H3 |
InChIKey | MLZSCKRIEGYCKD-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC2=CC=CC=C12)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |