For research use only. Not for therapeutic Use.
2-Cyano-5-nitroanisole (Cat.No:M006671) is a chemical compound known for its applications in organic synthesis. It contains a cyano group and a nitro group, making it a versatile building block for the development of various molecules. This compound has potential uses in pharmaceuticals, agrochemicals, and other industrial processes.
CAS Number | 101084-96-2 |
Molecular Formula | C8H6N2O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2-methoxy-4-nitrobenzonitrile |
InChI | InChI=1S/C8H6N2O3/c1-13-8-4-7(10(11)12)3-2-6(8)5-9/h2-4H,1H3 |
InChIKey | MLIKCKXLGYEGAO-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |