For research use only. Not for therapeutic Use.
2-(Cyanomethyl)benzonitrile is an organic compound featuring a benzonitrile structure with a cyanomethyl group (-CH₂CN) at the ortho position relative to the nitrile group. Its chemical formula is C₉H₈N₂. This compound is of interest in synthetic organic chemistry and materials science, often used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of both nitrile functionalities enhances its reactivity, making it suitable for diverse chemical transformations and applications in drug discovery and development.
CAS Number | 3759-28-2 |
Molecular Formula | C9H6N2 |
Purity | ≥95% |
IUPAC Name | 2-(cyanomethyl)benzonitrile |
InChI | InChI=1S/C9H6N2/c10-6-5-8-3-1-2-4-9(8)7-11/h1-4H,5H2 |
InChIKey | GKHSEDFDYXZGCG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CC#N)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |