For research use only. Not for therapeutic Use.
2-Cyclohexyl-1-phenylethan-1-amine(Cat No.:L007840), is a chemical compound with a cyclic structure. Its molecular formula is C14H21N. This compound falls into the category of amines, which are organic compounds derived from ammonia (NH3) by replacing hydrogen atoms with various substituents. Amines play a crucial role in biological processes and are widely used in the synthesis of pharmaceuticals, dyes, and other organic chemicals. The specific structure of 2-Cyclohexyl-1-phenylethan-1-amine suggests its potential use in medicinal chemistry, where such compounds are often explored for their diverse biological activities and therapeutic applications.
CAS Number | 4442-88-0 |
Molecular Formula | C14H21N |
Purity | ≥95% |
IUPAC Name | 2-cyclohexyl-1-phenylethanamine |
InChI | InChI=1S/C14H21N/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h2,5-6,9-10,12,14H,1,3-4,7-8,11,15H2 |
InChIKey | HFLQIMOFFSZGIH-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)CC(C2=CC=CC=C2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |