For research use only. Not for therapeutic Use.
2-Cyclohexyl-1-phenylethan-1-amine hydrochloride(Cat No.:L007372), is a chemical compound commonly used in medicinal chemistry and pharmaceutical research. Its molecular structure includes a cyclohexyl group and a phenyl group attached to an ethylamine backbone. The addition of a hydrochloride salt enhances its stability and solubility in aqueous solutions, making it suitable for various laboratory applications. Researchers utilize this compound as a precursor or intermediate in the synthesis of more complex molecules. Its controlled synthesis and manipulation play a crucial role in drug discovery, enabling scientists to explore its potential biological activities and interactions within the human body.
CAS Number | 82867-36-5 |
Molecular Formula | C14H22ClN |
Purity | ≥95% |
IUPAC Name | 2-cyclohexyl-1-phenylethanamine;hydrochloride |
InChI | InChI=1S/C14H21N.ClH/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12;/h2,5-6,9-10,12,14H,1,3-4,7-8,11,15H2;1H |
InChIKey | AYIPBMNZJFZUON-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)CC(C2=CC=CC=C2)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |