For research use only. Not for therapeutic Use.
2-Cyclohexylphenol (Cat No.:M069167) is a chemical compound. It features a cyclohexyl group attached to a phenol ring. This compound is utilized in industrial processes, primarily as an intermediate in the production of UV absorbers and antioxidants for polymers and plastics. Its cyclohexyl group imparts stability and compatibility in various materials. 2-Cyclohexylphenol’s role in modifying material properties contributes to its importance in enhancing the performance and longevity of plastics and other polymer-based products. Its industrial applications help to protect materials from degradation caused by exposure to ultraviolet radiation and environmental factors.
CAS Number | 119-42-6 |
Molecular Formula | C12H16O |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 2-cyclohexylphenol |
InChI | InChI=1S/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2 |
InChIKey | MVRPPTGLVPEMPI-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)C2=CC=CC=C2O |