For research use only. Not for therapeutic Use.
2-Cyclopropyl-2-hydroxyacetonitrile(Cat No.:L007426), is a chemical compound with important applications in organic synthesis and medicinal chemistry. This compound features a hydroxy group (-OH) and a nitrile group (-C≡N) attached to a cyclopropyl ring. The presence of both a hydroxy group and a nitrile group in its structure makes it valuable for various chemical transformations, enabling the creation of diverse molecular structures. Researchers commonly use it as a building block in the synthesis of pharmaceuticals and other biologically active compounds.
Catalog Number | L007426 |
CAS Number | 5648-87-3 |
Molecular Formula | C5H7NO |
Purity | ≥95% |
IUPAC Name | 2-cyclopropyl-2-hydroxyacetonitrile |
InChI | InChI=1S/C5H7NO/c6-3-5(7)4-1-2-4/h4-5,7H,1-2H2 |
InChIKey | ILJKKAIQFPEIBL-UHFFFAOYSA-N |
SMILES | C1CC1C(C#N)O |