Home
>
Chemical Reagents>Heterocyclic Building Blocks> (2-Cyclopropyl-5-methyl-1,3-oxazol-4-yl)methanol
For research use only. Not for therapeutic Use.
(2-Cyclopropyl-5-methyl-1,3-oxazol-4-yl)methanol(CAT: L000532) is a chemically significant compound with versatile applications, primarily in organic and pharmaceutical chemistry. Its action method primarily involves its role as a valuable intermediate for the synthesis of diverse molecules. In pharmaceutical chemistry, it serves as a crucial building block for the development of potential drug candidates and bioactive compounds due to its specific structure.
CAS Number | 1824614-59-6 |
Molecular Formula | C8H11NO2 |
Purity | ≥95% |
IUPAC Name | (2-cyclopropyl-5-methyl-1,3-oxazol-4-yl)methanol |
InChI | InChI=1S/C8H11NO2/c1-5-7(4-10)9-8(11-5)6-2-3-6/h6,10H,2-4H2,1H3 |
InChIKey | JCHFDZGFEPUFNA-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |