For research use only. Not for therapeutic Use.
2-D08 (CAT:I011808) is a small molecule inhibitor that targets the beta-catenin-TCF/LEF transcriptional complex involved in the Wnt signaling pathway. The Wnt pathway plays a crucial role in various cellular processes and its dysregulation has been linked to cancer and other diseases. By blocking beta-catenin-TCF/LEF transcription, 2-D08 has potential therapeutic applications in the treatment of Wnt-related diseases.
CAS Number | 144707-18-6 |
Synonyms | 2-(2,3,4-trihydroxyphenyl)-4H-1-benzopyran-4-one;2-D08; 144707-18-6; 2′,3′,4′-trihydroxyflavone; SCHEMBL1772778; CHEMBL3115475; AOB4275 |
Molecular Formula | C15H10O5 |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Solubility | Soluble in DMSO |
Storage | Store at 4°C |
IUPAC Name | 2-(2,3,4-trihydroxyphenyl)chromen-4-one |
InChI | InChI=1S/C15H10O5/c16-10-6-5-9(14(18)15(10)19)13-7-11(17)8-3-1-2-4-12(8)20-13/h1-7,16,18-19H |
InChIKey | JJAXTFSPCLZPIW-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=C(C(=C(C=C3)O)O)O |