For research use only. Not for therapeutic Use.
2-Deoxy-2-fluoro-D-glucose (Cat. No: R020675) is a carbohydrate compound that can be used as a biochemical reagent in the pharmaceutical industry, mainly for scientific research.
| Catalog Number | R020675 |
| CAS Number | 29702-43-0 |
| Synonyms | 2-Deoxy-2-fluoro-D-glucopyranose; 2-Deoxy-2-fluoroglucose; FDG; Fludeoxyglucose; |
| Molecular Formula | C6H11FO5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R,3S,4R,5R)-2-fluoro-3,4,5,6-tetrahydroxyhexanal |
| InChI | InChI=1S/C6H11FO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | AOYNUTHNTBLRMT-SLPGGIOYSA-N |
| SMILES | C(C(C(C(C(C=O)F)O)O)O)O |
