For research use only. Not for therapeutic Use.
2′-Deoxy-2′-fluorocytidine hydrate（Cat No.:L028882）is a modified nucleoside used in pharmaceutical research, particularly in the development of antiviral and anticancer therapies. Featuring a fluorine atom substitution at the 2′ position of the deoxyribose sugar, this compound mimics natural nucleosides but with enhanced stability and altered biochemical properties. Its structure makes it a key component in nucleic acid-based drug design, particularly for targeting viral replication and cancer cell proliferation. The hydrate form ensures stability and solubility, making it essential for advanced medicinal chemistry and therapeutic development.
| Catalog Number | L028882 |
| CAS Number | 1820580-34-4 |
| Molecular Formula | C9H14FN3O5 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrate |
| InChI | InChI=1S/C9H12FN3O4.H2O/c10-6-7(15)4(3-14)17-8(6)13-2-1-5(11)12-9(13)16;/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16);1H2/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | KUYKYENKWWNPHG-IAIGYFSYSA-N |
| SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)F.O |
