2-Deoxy-D-glucose-13C（Cat No.:S000456） is a labeled version of 2-deoxy-D-glucose, where the carbon atoms are enriched with the stable isotope carbon-13 (13C). This modification is utilized in biochemical and medical research, particularly in metabolic studies, as 2-deoxy-D-glucose interferes with glucose metabolism by inhibiting glycolysis after its phosphorylation to 2-deoxyglucose-6-phosphate. It’s often used in cancer research to target the enhanced glycolytic activity of cancer cells. The inclusion of the 13C label allows for precise tracing and imaging of metabolic pathways, aiding in the understanding of disease processes and the development of targeted therapies.
| Catalog Number | S000456 |
| CAS Number | 201612-55-7 |
| Molecular Formula | C513CH12O5 |
| Purity | 95% |
| IUPAC Name | (4R,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,4,5-triol |
| InChI | InChI=1S/C6H12O5/c7-2-4-6(10)3(8)1-5(9)11-4/h3-10H,1-2H2/t3-,4-,5?,6+/m1/s1/i5+1 |
| InChIKey | PMMURAAUARKVCB-UPKQYVFDSA-N |
| SMILES | C1C(C(C(OC1O)CO)O)O |
