For research use only. Not for therapeutic Use.
2-Deoxy-D-ribose-13C5 is a stable isotope-labeled form of 2-deoxy-D-ribose, a sugar molecule used in biochemical research and isotopic labeling studies. The presence of thirteen carbon-13 atoms in its structure allows for precise tracking and identification using analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy. This labeled compound aids in metabolic studies and elucidating biochemical pathways in biological systems.
Catalog Number | R041104 |
CAS Number | 266998-43-0 |
Synonyms | 2-Deoxy-D-erythro-pentose-13C5; 2-Deoxy-D-arabinose-13C5; D-(-)-2-Deoxyribose-13C5; Deoxyribose-5-13C; Thyminose-5-13C; |
Molecular Formula | 13C5 H10 O4 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | (4S,5R)-oxane-2,4,5-triol |
InChI | InChI=1S/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2/t3-,4+,5?/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
InChIKey | ZVQAVWAHRUNNPG-PWIBPOKESA-N |
SMILES | C1C(C(COC1O)O)O |