For research use only. Not for therapeutic Use.
2-Deoxy-D-ribose-5,5’-d2 is a deuterated sugar molecule essential for advanced biochemical and pharmaceutical research. This isotopically labeled version, with two deuterium atoms, is crucial for studying DNA synthesis, metabolic pathways, and molecular interactions. It offers enhanced stability and precise analytical results due to its stable isotope labeling. Ideal for research in nucleic acid chemistry and drug development, 2-Deoxy-D-ribose-5,5’-d2 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations. Optimize your research accuracy with this reliable deuterated compound.
CAS Number | 478511-68-1 |
Synonyms | 2-Deoxy-D-erythro-pentose-5,5’-d2; 2-Deoxy-D-arabinose-5,5’-d2; D-(-)-2-Deoxyribose-5,5’-d2; Deoxyribose-5,5’-d2; Thyminose-5,5’-d2; |
Molecular Formula | C5H10O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Desiccate at RT |
IUPAC Name | 6,6-dideuteriooxane-2,4,5-triol |
InChI | InChI=1S/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2/i2D2 |
InChIKey | ZVQAVWAHRUNNPG-CBTSVUPCSA-N |
SMILES | C1C(C(COC1O)O)O |