For research use only. Not for therapeutic Use.
2-Deoxy-D-ribose (Cat.No:R000078) is a simple sugar molecule and a deoxy sugar derived from ribose by replacing the hydroxyl group at the 2nd carbon with a hydrogen atom. It is a fundamental component of DNA and RNA molecules, playing a crucial role in genetic information storage and transfer.
Catalog Number | R000078 |
CAS Number | 533-67-5 |
Synonyms | 2-Deoxy-D-erythro-pentose; 2-Deoxy-D-arabinose; D-(-)-2-Deoxyribose; Deoxyribose; Thyminose; |
Molecular Formula | C5H10O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (3S,4R)-3,4,5-trihydroxypentanal |
InChI | InChI=1S/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2/t4-,5+/m0/s1 |
InChIKey | ASJSAQIRZKANQN-CRCLSJGQSA-N |
SMILES | C(C=O)C(C(CO)O)O |