2′-Deoxyadenosine Monohydrate-13C5 (Cat No.:C000846) is a stable isotope-labeled form of 2′-deoxyadenosine, a nucleoside that plays a crucial role in DNA synthesis and repair. The “13C5” notation indicates that five carbon atoms in the molecule are replaced with the stable isotope carbon-13. This labeling allows for precise isotope tracking in biochemical and biomedical research. 2′-Deoxyadenosine Monohydrate-13C5 is used as an internal standard in mass spectrometry and metabolic studies, facilitating accurate quantification and identification of 2′-deoxyadenosine in biological samples. Its use contributes to a deeper understanding of nucleotide metabolism and DNA-related processes, advancing research in genetics and molecular biology.
Catalog Number | C000846 |
CAS Number | 478510-79-1 |
Synonyms | 2’-Deoxy-β-D-adenosine-13C5 Monohydrate; ; 9-(2-Deoxy-β-D-erythro-pentofuranosyl) |
Molecular Formula | C₅¹³C₅H₁₃N₅O₃•H₂O |
Purity | 95% |
Solubility | Methanol (Slightly), Water (Slightly, Heated) |
Storage | 4°C, Inert atmosphere |
IUPAC Name | (2R,3R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate |
InChI | InChI=1S/C10H13N5O3.H2O/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7;/h3-7,16-17H,1-2H2,(H2,11,12,13);1H2/t5-,6-,7-;/m1./s1/i1+1,5+1,6+1,7+1; |
InChIKey | WZJWHIMNXWKNTO-PEBSFZIHSA-N |
SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)CO)O.O |
Reference | Gordon, C., et al.: J. Med. Chem., 48, 1 (2005), Ikejiri, M., et al.: Bioorg. Med. Chem., 15, 6882 (2007), |