For research use only. Not for therapeutic Use.
Deoxyguanosine HCl（Cat No.:I003455）, also known as 2′-deoxyguanosine HCl, is a nucleoside composed of the purine base guanine and the sugar deoxyribose. It is a key component of DNA, where it is incorporated into the DNA strand during replication and serves as one of the building blocks for genetic material. Deoxyguanosine HCl plays a critical role in maintaining the stability and integrity of the genome. It is commonly used in biochemical and molecular biology research to study DNA structure, function, and interactions.
| Catalog Number | I003455 |
| CAS Number | 3992-42-5 |
| Molecular Formula | C9H14ClN3O4 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | H2O: ≥ 41 mg/mL |
| Storage | Store at RT. |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride |
| InChI | InChI=1S/C9H13N3O4.ClH/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8;/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15);1H/t5-,6+,8+;/m0./s1 |
| InChIKey | LTKCXZGFJFAPLY-OERIEOFYSA-N |
| SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)CO)O.Cl |
| Reference | <p style=/line-height:25px/> |
