For research use only. Not for therapeutic Use.
2′-Deoxyguanosine-13C10,15N5(Cat No.:S000521) is an isotopically labeled variant of 2′-deoxyguanosine, where all ten carbon atoms are replaced with carbon-13 (13C) and all five nitrogen atoms are replaced with nitrogen-15 (15N). This modification significantly enhances the molecule’s traceability in nucleic acid research, particularly in DNA studies using techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. The labeled deoxyguanosine enables precise tracking of DNA synthesis, repair, and metabolism processes.
CAS Number | 872624-05-0 |
Molecular Formula | 13C10H1315N5O4 |
Purity | ≥95% |
IUPAC Name | 2-(15N)azanyl-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1H-purin-6-one |
InChI | InChI=1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1 |
InChIKey | YKBGVTZYEHREMT-XEJNDJRBSA-N |
SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O |