For research use only. Not for therapeutic Use.
2′-Deoxyguanosine（Cat No.:I005697）is a nucleoside that forms the building block for DNA, composed of the purine base guanine attached to a deoxyribose sugar molecule. It is essential for DNA synthesis and repair. As a key component of the nucleotide pool, it is incorporated into DNA during replication and transcription processes. 2′-Deoxyguanosine has been studied for its role in various biological processes, including its involvement in DNA damage and repair mechanisms. Additionally, its analogs are explored in cancer therapy as potential chemotherapy agents, as they can inhibit DNA synthesis in rapidly dividing cells.
| Catalog Number | I005697 |
| CAS Number | 961-07-9 |
| Molecular Formula | C10H13N5O4 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Solubility | DMSO: ≥ 42 mg/mL |
| Storage | -20°C |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChI | InChI=1S/C10H13N5O4/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6/h3-6,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,6+/m0/s1 |
| InChIKey | YKBGVTZYEHREMT-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)O |
| Reference | [1]. Deoxyguanosine, From Wikipedia |
