For research use only. Not for therapeutic Use.
2-(Diethylamino)ethanethiol is an organosulfur compound with the formula C6H15NS. It features a diethylamino group attached to an ethanethiol backbone. This compound is used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its unique structure makes it valuable for creating thiol-based reagents and catalysts, contributing to various chemical reactions and industrial applications.
Catalog Number | R049201 |
CAS Number | 100-38-9 |
Synonyms | (2-Mercaptoethyl)diethylamine; 2-(Diethylamino)ethanethiol; 2-(Diethylamino)ethyl mercaptan; 2-(N,N-Diethylamino)ethanethiol; Diethyl(2-mercaptoethyl)amine; Diethylcysteamine; N,N-Diethylcysteamine; NSC 49193; |
Molecular Formula | C6H15NS |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-(diethylamino)ethanethiol |
InChI | InChI=1S/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
InChIKey | YBDSNEVSFQMCTL-UHFFFAOYSA-N |
SMILES | CCN(CC)CCS |