For research use only. Not for therapeutic Use.
2-(Difluoromethoxy)phenol（Cat No.:L018349）is a chemical compound that includes a phenol group substituted with a difluoromethoxy group at the 2-position. This structure combines the reactive nature of phenol with the electron-withdrawing effects of the difluoromethoxy group, enhancing its chemical stability and altering its electronic properties. This compound is particularly valuable in the synthesis of pharmaceuticals and agrochemicals, where it can be used to introduce fluorine atoms that improve metabolic stability and increase biological activity. The presence of the methoxy group also makes it a versatile intermediate for further chemical transformations in advanced organic synthesis.
| Catalog Number | L018349 |
| CAS Number | 53104-96-4 |
| Molecular Formula | C7H6F2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(difluoromethoxy)phenol |
| InChI | InChI=1S/C7H6F2O2/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7,10H |
| InChIKey | PVNTURWWDZNXTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)O)OC(F)F |
