For research use only. Not for therapeutic Use.
(2-(Difluoromethoxy)pyridin-4-yl)boronic acid(CAT: L016382) is a high-purity organoboron compound featuring a pyridine ring substituted with a difluoromethoxy group at the 2-position and a boronic acid moiety at the 4-position. This versatile molecule is widely used in pharmaceutical and chemical research as a key intermediate in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Its unique structure and reactivity make it an ideal building block for the synthesis of bioactive molecules, including enzyme inhibitors and receptor modulators. (2-(Difluoromethoxy)pyridin-4-yl)boronic acid supports innovative advancements in medicinal chemistry, agrochemical development, and material science.
CAS Number | 1678539-02-0 |
Molecular Formula | C6H6BF2NO3 |
Purity | ≥95% |
IUPAC Name | [2-(difluoromethoxy)pyridin-4-yl]boronic acid |
InChI | InChI=1S/C6H6BF2NO3/c8-6(9)13-5-3-4(7(11)12)1-2-10-5/h1-3,6,11-12H |
InChIKey | YWYAZZQOOGAGAE-UHFFFAOYSA-N |
SMILES | B(C1=CC(=NC=C1)OC(F)F)(O)O |