For research use only. Not for therapeutic Use.
2-(Difluoromethyl)-5-iodo-4-hydroxypyridine(Cat No.:L002306)is a specialized organic compound used extensively in medicinal chemistry. The pyridine ring, a common scaffold in drug design, is modified with a difluoromethyl group at the 2-position, enhancing the molecule’s metabolic stability and electronic properties. The 5-iodo substitution facilitates further functionalization through cross-coupling reactions, while the 4-hydroxy group increases solubility and offers additional reactive sites. This compound serves as a versatile intermediate in the synthesis of complex pharmaceuticals, playing a crucial role in the development of new therapeutics with improved pharmacokinetic profiles.
CAS Number | 1806780-31-3 |
Molecular Formula | C6H4F2INO |
Purity | ≥95% |
IUPAC Name | 2-(difluoromethyl)-5-iodo-1H-pyridin-4-one |
InChI | InChI=1S/C6H4F2INO/c7-6(8)4-1-5(11)3(9)2-10-4/h1-2,6H,(H,10,11) |
InChIKey | RYSYPJUYDXGFDN-UHFFFAOYSA-N |
SMILES | C1=C(NC=C(C1=O)I)C(F)F |