For research use only. Not for therapeutic Use.
2-(Dimethylamino)-6-fluorobenzamide (Cat.No:L003828) is a notable chemical compound widely employed in pharmaceutical research. Its distinct structure, featuring a fluorobenzamide moiety, imparts unique reactivity and pharmacological properties. This compound is a key intermediate in the synthesis of various pharmaceutical agents, highlighting its significance in drug development processes.
Catalog Number | L003828 |
CAS Number | 107485-44-9 |
Molecular Formula | C9H11FN2O |
Purity | ≥95% |
IUPAC Name | 2-(dimethylamino)-6-fluorobenzamide |
InChI | InChI=1S/C9H11FN2O/c1-12(2)7-5-3-4-6(10)8(7)9(11)13/h3-5H,1-2H3,(H2,11,13) |
InChIKey | OOCPQLDZKZSIEG-UHFFFAOYSA-N |
SMILES | CN(C)C1=C(C(=CC=C1)F)C(=O)N |