For research use only. Not for therapeutic Use.
2-(dimethylamino)-N-(4-nitrophenyl)acetamide(CAT: L000335) is a compound with significant relevance in the field of pharmaceutical chemistry. This chemical, featuring a dimethylamino group and a nitrophenyl moiety, is often used as an important intermediate in the synthesis of various pharmaceuticals. It serves as a key building block for the preparation of drugs with diverse pharmacological properties.
CAS Number | 25786-08-7 |
Molecular Formula | C10H13N3O3 |
Purity | ≥95% |
IUPAC Name | 2-(dimethylamino)-N-(4-nitrophenyl)acetamide |
InChI | InChI=1S/C10H13N3O3/c1-12(2)7-10(14)11-8-3-5-9(6-4-8)13(15)16/h3-6H,7H2,1-2H3,(H,11,14) |
InChIKey | RAUBZYQVBHPQPD-UHFFFAOYSA-N |