For research use only. Not for therapeutic Use.
2-(Dimethylamino)benzonitrile is an aromatic compound featuring a dimethylamino group at the 2-position and a nitrile group at the benzene ring. This compound is significant in organic synthesis and fluorescence studies due to its unique electron-donating and withdrawing groups, which influence its photophysical properties. It is commonly used as a fluorescent probe in research, particularly for studying molecular environments. Its structure also allows for further chemical modifications, making it valuable in the development of pharmaceuticals and other advanced materials.
| Catalog Number | L012096 |
| CAS Number | 20925-24-0 |
| Molecular Formula | C9H10N2 |
| Purity | ≥95% |
| IUPAC Name | 2-(dimethylamino)benzonitrile |
| InChI | InChI=1S/C9H10N2/c1-11(2)9-6-4-3-5-8(9)7-10/h3-6H,1-2H3 |
| InChIKey | OEULOFHGYOFYEC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC=C1C#N |
