For research use only. Not for therapeutic Use.
2-(Dimethylamino)benzonitrile is an aromatic compound featuring a dimethylamino group at the 2-position and a nitrile group at the benzene ring. This compound is significant in organic synthesis and fluorescence studies due to its unique electron-donating and withdrawing groups, which influence its photophysical properties. It is commonly used as a fluorescent probe in research, particularly for studying molecular environments. Its structure also allows for further chemical modifications, making it valuable in the development of pharmaceuticals and other advanced materials.
CAS Number | 20925-24-0 |
Molecular Formula | C9H10N2 |
Purity | ≥95% |
IUPAC Name | 2-(dimethylamino)benzonitrile |
InChI | InChI=1S/C9H10N2/c1-11(2)9-6-4-3-5-8(9)7-10/h3-6H,1-2H3 |
InChIKey | OEULOFHGYOFYEC-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC=CC=C1C#N |