For research use only. Not for therapeutic Use.
2-(Dimethylamino)ethyl acrylate(CAT: L045856) is a high-purity organic compound featuring an acrylate ester with a dimethylaminoethyl group. This versatile molecule is widely used in polymer chemistry and organic synthesis, serving as a key monomer or intermediate in the development of functional materials, coatings, and adhesives. Its structure, combining an acrylate moiety and a basic amino group, makes it suitable for copolymerization and surface modification applications. 2-(Dimethylamino)ethyl acrylate is also valuable in pharmaceutical research, enabling the synthesis of drug delivery systems and bioactive molecules, supporting innovation across material science and medicinal chemistry.
CAS Number | 2439-35-2 |
Molecular Formula | C7H13NO2 |
Purity | ≥95% |
IUPAC Name | 2-(dimethylamino)ethyl prop-2-enoate |
InChI | InChI=1S/C7H13NO2/c1-4-7(9)10-6-5-8(2)3/h4H,1,5-6H2,2-3H3 |
InChIKey | DPBJAVGHACCNRL-UHFFFAOYSA-N |
SMILES | CN(C)CCOC(=O)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |