Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride
2-(Dimethylamino)pyridine-3-carboxylic acid hydrochloride(Cat No.:L007622), is a chemical compound featuring a pyridine ring substituted with a dimethylamino group at the 2-position and a carboxylic acid group at the 3-position, in the form of a hydrochloride salt. This specific molecular structure is important in organic synthesis and medicinal chemistry. Researchers utilize it as a catalyst in various chemical reactions, particularly in the synthesis of pharmaceuticals and fine chemicals. Its catalytic properties make it valuable in facilitating transformations in organic molecules, contributing significantly to advancements in synthetic chemistry and the development of specialized compounds for research and industrial applications.
Catalog Number | L007622 |
CAS Number | 1177289-23-4 |
Molecular Formula | C8H11ClN2O2 |
Purity | ≥95% |
IUPAC Name | 2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride |
InChI | InChI=1S/C8H10N2O2.ClH/c1-10(2)7-6(8(11)12)4-3-5-9-7;/h3-5H,1-2H3,(H,11,12);1H |
InChIKey | DYSKZQWSXJTYLG-UHFFFAOYSA-N |
SMILES | CN(C)C1=C(C=CC=N1)C(=O)O.Cl |