For research use only. Not for therapeutic Use.
2-(Diphenylphosphino)aniline is an organophosphorus compound widely used in coordination chemistry and catalysis. Featuring an aniline backbone with a diphenylphosphino group, it serves as a bidentate ligand, facilitating complex formation with transition metals. This compound is valuable in catalytic applications, such as in cross-coupling reactions, where it enhances reaction efficiency and selectivity. Its structure allows it to stabilize metal centers, making it essential in developing catalysts for organic synthesis, including pharmaceutical and material science applications.
| Catalog Number | L036329 |
| CAS Number | 65423-44-1 |
| Molecular Formula | C18H16NP |
| Purity | ≥95% |
| IUPAC Name | 2-diphenylphosphanylaniline |
| InChI | InChI=1S/C18H16NP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,19H2 |
| InChIKey | WIJJGRVJLNMTCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3 |
