For research use only. Not for therapeutic Use.
2-Dodecenoic acid(CAT: R015620) is an unsaturated fatty acid that has garnered attention for its signaling properties in bacterial communication, particularly in quorum sensing. This compound, also known as a signaling molecule, plays a key role in the regulation of microbial biofilm formation and the expression of virulence factors. 2-Dodecenoic acid has been studied for its potential antimicrobial and antibiofilm activities, offering promise in therapeutic approaches against bacterial infections. Its role in modulating bacterial behavior makes it a valuable target for research aimed at controlling pathogenic bacteria and mitigating antibiotic resistance.
CAS Number | 32466-54-9 |
Synonyms | trans-2-Dodecenoic acid; (2E)-2-Dodecenoic acid; |
Molecular Formula | C12H22O2 |
Purity | ≥95% |
IUPAC Name | (E)-dodec-2-enoic acid |
InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/b11-10+ |
InChIKey | PAWGRNGPMLVJQH-ZHACJKMWSA-N |
SMILES | CCCCCCCCCC=CC(=O)O |