For research use only. Not for therapeutic Use.
2-Dodecenoic acid, also known as erucic acid, is a monounsaturated omega-9 fatty acid found in certain plant oils like rapeseed and mustard seed oil. It is widely used in industrial applications, including the production of lubricants, cosmetics, and plasticizers. However, excessive consumption of erucic acid has been associated with adverse health effects, such as heart disease. Therefore, its use in food products is regulated in some jurisdictions.
| Catalog Number | R044531 |
| CAS Number | 4412-16-2 |
| Synonyms | NSC 59856 |
| Molecular Formula | C12H22O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-dodec-2-enoic acid |
| InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/b11-10+ |
| InChIKey | PAWGRNGPMLVJQH-ZHACJKMWSA-N |
| SMILES | CCCCCCCCCC=CC(=O)O |
