For research use only. Not for therapeutic Use.
2-(Dodecylthiocarbonothioylthio)propanoic acid(CAT: L000387) is a chemical compound with applications primarily in organic chemistry and potentially in material science. This compound can serve as an important intermediate for the synthesis of various organic molecules, particularly those with thioester functionalities. In organic chemistry, it may be used for creating compounds with specific properties or as an intermediate for the development of specialty chemicals.
CAS Number | 558484-21-2 |
Molecular Formula | C16H30O2S3 |
Purity | ≥95% |
IUPAC Name | 2-dodecylsulfanylcarbothioylsulfanylpropanoic acid |
InChI | InChI=1S/C16H30O2S3/c1-3-4-5-6-7-8-9-10-11-12-13-20-16(19)21-14(2)15(17)18/h14H,3-13H2,1-2H3,(H,17,18) |
InChIKey | CFCFZJHCTNKHGJ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |