For research use only. Not for therapeutic Use.
2-DPMP (hydrochloride), also known as Desoxypipradrol, is a potent stimulant drug that affects the central nervous system. It works by inhibiting the reuptake of dopamine and norepinephrine, leading to increased concentrations of these neurotransmitters in the brain, which results in enhanced alertness, focus, and euphoria. 2-DPMP has a long duration of action, which can lead to prolonged stimulation and potential side effects such as insomnia, anxiety, and agitation. Due to its strong stimulant properties and potential for abuse, 2-DPMP is regulated in many countries and has been associated with legal and health concerns.
CAS Number | 5807-81-8 |
Synonyms | Desoxypipradrol;2-Diphenylmethylpiperidine |
Molecular Formula | C18H22ClN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-benzhydrylpiperidine;hydrochloride |
InChI | InChI=1S/C18H21N.ClH/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17;/h1-6,9-12,17-19H,7-8,13-14H2;1H |
InChIKey | NTADPDIPKMRRQV-UHFFFAOYSA-N |
SMILES | C1CCNC(C1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl |