Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> (2-Ethoxy-benzyl)-(2,2,6,6-tetramethyl-piperidin-4-yl)-amine
For research use only. Not for therapeutic Use.
(2-Ethoxy-benzyl)-(2,2,6,6-tetramethyl-piperidin-4-yl)-amine (Cat No.:L019357) is a chemical compound featuring a piperidine ring with a 2,2,6,6-tetramethyl group and an amine group at one end. At the other end, a benzyl group is connected with an ethoxy substituent. This compound holds potential applications in organic synthesis and medicinal chemistry due to its unique structure. The presence of both a piperidine and an ethoxy-benzyl group makes it potentially valuable for drug design and interactions with biological systems.
CAS Number | 626213-00-1 |
Molecular Formula | C18H30N2O |
Purity | ≥95% |
IUPAC Name | N-[(2-ethoxyphenyl)methyl]-2,2,6,6-tetramethylpiperidin-4-amine |
InChI | InChI=1S/C18H30N2O/c1-6-21-16-10-8-7-9-14(16)13-19-15-11-17(2,3)20-18(4,5)12-15/h7-10,15,19-20H,6,11-13H2,1-5H3 |
InChIKey | IXSBXJAOUMNUOC-UHFFFAOYSA-N |
SMILES | CCOC1=CC=CC=C1CNC2CC(NC(C2)(C)C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |