For research use only. Not for therapeutic Use.
2-Ethoxypropene is a high-purity compound used in synthetic organic chemistry and polymer research. This reactive alkene is essential for studying polymerization processes and creating specialized polymers. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, it enhances research accuracy and efficiency.
Catalog Number | R024382 |
CAS Number | 926-66-9 |
Synonyms | 2-Ethoxy-1-propene; 2-Ethoxypropene; Ethyl 1-Methylvinyl Ether; Ethyl Isopropenyl Ether?? |
Molecular Formula | C5H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-ethoxyprop-1-ene |
InChI | InChI=1S/C5H10O/c1-4-6-5(2)3/h2,4H2,1,3H3 |
InChIKey | FSGHEPDRMHVUCQ-UHFFFAOYSA-N |
SMILES | CCOC(=C)C |