For research use only. Not for therapeutic Use.
2-Ethyl-3-methoxy-4H-pyran-4-one (Cat.No:L004205) is a significant compound with diverse applications. Known for its unique pyranone structure, it is utilized in the food and fragrance industries as a flavoring agent and aroma enhancer. This compound also exhibits potential pharmaceutical properties, making it a subject of interest in drug development. Its versatility and distinct aroma profile contribute to its importance in contemporary chemical research and its role in various industries.
Catalog Number | L004205 |
CAS Number | 50741-69-0 |
Molecular Formula | C8H10O3 |
Purity | ≥95% |
IUPAC Name | 2-ethyl-3-methoxypyran-4-one |
InChI | InChI=1S/C8H10O3/c1-3-7-8(10-2)6(9)4-5-11-7/h4-5H,3H2,1-2H3 |
InChIKey | FKSXDOOHTFCNOF-UHFFFAOYSA-N |
SMILES | CCC1=C(C(=O)C=CO1)OC |