For research use only. Not for therapeutic Use.
2-Ethyl-3-methylbutan-1-ol(Cat No.:L043816)is a branched-chain alcohol that plays a significant role in the synthesis of fragrances, flavors, and specialty chemicals. Its unique molecular structure, characterized by an ethyl group and a methyl group on a butanol backbone, imparts distinct olfactory properties, making it valuable in the production of perfumes and flavoring agents. Additionally, this alcohol is used as a solvent and intermediate in organic synthesis, contributing to the development of fine chemicals and pharmaceuticals. Its versatility and reactivity make it essential in industrial applications.
CAS Number | 32444-34-1 |
Molecular Formula | C7H16O |
Purity | ≥95% |
IUPAC Name | 2-ethyl-3-methylbutan-1-ol |
InChI | InChI=1S/C7H16O/c1-4-7(5-8)6(2)3/h6-8H,4-5H2,1-3H3 |
InChIKey | OXFFPTMSBXBVLZ-UHFFFAOYSA-N |
SMILES | CCC(CO)C(C)C |