For research use only. Not for therapeutic Use.
2-Ethyl 5-Methyl 1H-Indole-2,5-Dicarboxylate(CAT: L014940) is a high-purity compound featuring a versatile indole core substituted with ethyl and methyl ester groups at the 2 and 5 positions. This unique molecular structure offers significant utility in pharmaceutical, agrochemical, and material science research, serving as a valuable intermediate in the synthesis of complex organic molecules. Its dual carboxylate functionalities enable diverse chemical transformations, facilitating drug discovery, catalyst design, and the development of advanced materials. 2-Ethyl 5-Methyl 1H-Indole-2,5-Dicarboxylate ensures consistent performance and stability, supporting innovative applications across a broad spectrum of scientific investigations.
CAS Number | 884494-66-0 |
Molecular Formula | C13H13NO4 |
Purity | ≥95% |
IUPAC Name | 2-O-ethyl 5-O-methyl 1H-indole-2,5-dicarboxylate |
InChI | InChI=1S/C13H13NO4/c1-3-18-13(16)11-7-9-6-8(12(15)17-2)4-5-10(9)14-11/h4-7,14H,3H2,1-2H3 |
InChIKey | DFILAPAOMFUIAA-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(=O)OC |