For research use only. Not for therapeutic Use.
2-Ethyl-5-(trifluoromethyl)benzenamine(Cat No.:L007887), with the chemical formula C9H10F3N. It is a compound featuring a trifluoromethyl-substituted benzene ring with an ethylamine group at the 2-position. Compounds with trifluoromethyl groups often possess unique physicochemical properties and are significant in medicinal chemistry and agrochemical research. The presence of the ethylamine group provides reactivity, making this compound valuable in organic synthesis. Researchers use similar compounds as building blocks for the development of pharmaceuticals and specialty chemicals, exploring their potential in the creation of diverse and functionalized molecules for various applications in drug discovery and related scientific endeavors.
CAS Number | 1369923-98-7 |
Molecular Formula | C9H10F3N |
Purity | ≥95% |
IUPAC Name | 2-ethyl-5-(trifluoromethyl)aniline |
InChI | InChI=1S/C9H10F3N/c1-2-6-3-4-7(5-8(6)13)9(10,11)12/h3-5H,2,13H2,1H3 |
InChIKey | MOJQDGQMSMYUDN-UHFFFAOYSA-N |
SMILES | CCC1=C(C=C(C=C1)C(F)(F)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |