For research use only. Not for therapeutic Use.
2-Ethyl-5,7-dimethyl-3H-imidazo[4,5-b]pyridine is a heterocyclic compound crucial for advanced pharmaceutical and chemical research. Known for its unique structural properties, this compound is used in the synthesis of various bioactive molecules and pharmaceuticals. Its role in studying chemical reactions and molecular interactions makes it invaluable for drug discovery and development. 2-Ethyl-5,7-dimethyl-3H-imidazo[4,5-b]pyridine is highly valued for its purity and stability, providing reliable results in innovative research and therapeutic advancements.
CAS Number | 133240-06-9 |
Synonyms | 5,7-Dimethyl-2-ethylimidazo[4,5-b]pyridine; |
Molecular Formula | C10H13N3 |
Purity | ≥95% |
Target | Angiotensin Receptor |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 2-ethyl-5,7-dimethyl-1H-imidazo[4,5-b]pyridine |
InChI | InChI=1S/C10H13N3/c1-4-8-12-9-6(2)5-7(3)11-10(9)13-8/h5H,4H2,1-3H3,(H,11,12,13) |
InChIKey | XWWJWZJOSWSJQV-UHFFFAOYSA-N |
SMILES | CCC1=NC2=C(N1)C(=CC(=N2)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |