For research use only. Not for therapeutic Use.
2-Ethyl-6-methoxypyridin-3-amine(Cat No.:L007357), is a chemical compound utilized in research and pharmaceutical applications. Its molecular structure consists of a pyridine ring with ethyl and methoxy substituents, making it valuable for scientific investigations. Researchers employ this compound to study its interactions with biological molecules, potentially leading to the development of novel drugs or therapeutic agents. Compounds like 2-ethyl-6-methoxypyridin-3-amine are fundamental in the realm of medicinal chemistry, aiding scientists in their quest to unravel biological mechanisms and create innovative solutions for various health-related challenges.
CAS Number | 1616415-91-8 |
Molecular Formula | C8H12N2O |
Purity | ≥95% |
IUPAC Name | 2-ethyl-6-methoxypyridin-3-amine |
InChI | InChI=1S/C8H12N2O/c1-3-7-6(9)4-5-8(10-7)11-2/h4-5H,3,9H2,1-2H3 |
InChIKey | ZKUMTRWQMFLGBD-UHFFFAOYSA-N |
SMILES | CCC1=C(C=CC(=N1)OC)N |