For research use only. Not for therapeutic Use.
2-Ethyl-m-xylene is a high-purity aromatic hydrocarbon essential for advanced pharmaceutical and chemical research. This xylene derivative is crucial for studies involving organic synthesis, solvent applications, and chemical intermediates. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R021068 |
CAS Number | 2870-04-4 |
Synonyms | 1,3-Dimethyl-2-ethylbenzene; 1-Ethyl-2,6-dimethylbenzene; 2,6-Dimethyl-1-ethylbenzene; 2-Ethyl-1,3-dimethylbenzene; |
Molecular Formula | C10H14 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2-ethyl-1,3-dimethylbenzene |
InChI | InChI=1S/C10H14/c1-4-10-8(2)6-5-7-9(10)3/h5-7H,4H2,1-3H3 |
InChIKey | CHIKRULMSSADAF-UHFFFAOYSA-N |
SMILES | CCC1=C(C=CC=C1C)C |