For research use only. Not for therapeutic Use.
2-Ethyl-N,N-dimethylhexylamine (Cat.No:L004149) is a crucial organic compound with versatile applications. Its unique structure, featuring an ethyl group and dimethylhexylamine moiety, grants it distinctive reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules, finding applications in various industries including pharmaceuticals, agrochemicals, and more.
CAS Number | 28056-87-3 |
Molecular Formula | C10H23N |
Purity | ≥95% |
IUPAC Name | 2-ethyl-N,N-dimethylhexan-1-amine |
InChI | InChI=1S/C10H23N/c1-5-7-8-10(6-2)9-11(3)4/h10H,5-9H2,1-4H3 |
InChIKey | OQADVBLQZQTGLL-UHFFFAOYSA-N |
SMILES | CCCCC(CC)CN(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |