For research use only. Not for therapeutic Use.
2-Ethylbiphenyl（Cat No.:M121245） is a chemical compound consisting of a biphenyl molecule with an ethyl group attached to one of the phenyl rings. It is a colorless liquid with a molecular formula C14H14 and is commonly used as a solvent and heat transfer fluid in various industrial applications. 2-Ethylbiphenyl is also employed as a research chemical and as a starting material in the synthesis of other organic compounds. Its chemical structure and properties make it useful in organic synthesis and as a solvent for organic reactions.
| Catalog Number | M121245 |
| CAS Number | 1812-51-7 |
| Synonyms | 2-Ethylbiphenyl; 1-Ethyl-2-phenylbenzene; |
| Molecular Formula | C14H14 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-ethyl-2-phenylbenzene |
| InChI | InChI=1S/C14H14/c1-2-12-8-6-7-11-14(12)13-9-4-3-5-10-13/h3-11H,2H2,1H3 |
| InChIKey | DLMYHUARHITGIJ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC=C1C2=CC=CC=C2 |
