For research use only. Not for therapeutic Use.
2-Ethylcyclopentanone(CAT: L019083) is a cyclic ketone with a five-membered cyclopentane ring substituted by an ethyl group at the 2nd position. This compound is frequently used as an intermediate in organic synthesis, especially in the development of pharmaceuticals, fragrances, and fine chemicals. Its ketone functional group provides reactivity for various chemical reactions, including nucleophilic additions, reductions, and condensations, making it a versatile building block for the construction of more complex molecules. Additionally, its cyclic structure contributes to the creation of stable frameworks in both chemical research and industrial applications.
| Catalog Number | L019083 |
| CAS Number | 4971-18-0 |
| Molecular Formula | C7H12O |
| Purity | ≥95% |
| IUPAC Name | 2-ethylcyclopentan-1-one |
| InChI | InChI=1S/C7H12O/c1-2-6-4-3-5-7(6)8/h6H,2-5H2,1H3 |
| InChIKey | PPTKUTYPOKHBTL-UHFFFAOYSA-N |
