For research use only. Not for therapeutic Use.
2-Ethylhexyl acrylate (Cat No.:M068054) is a chemical compound. It comprises an acrylate group attached to a 2-ethylhexyl (octyl) side chain. This compound is significant in polymer chemistry and industrial applications as a monomer used in the synthesis of various polymers, including adhesives, coatings, and elastomers. Its reactivity in polymerization processes contributes to the creation of materials with specific properties, such as flexibility and adhesion strength. 2-Ethylhexyl acrylate’s role as a monomer enhances its importance in producing functional polymers for diverse applications, contributing to the advancement of materials science and industrial technology.
CAS Number | 103-11-7 |
Molecular Formula | C11H20O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-ethylhexyl prop-2-enoate |
InChI | InChI=1S/C11H20O2/c1-4-7-8-10(5-2)9-13-11(12)6-3/h6,10H,3-5,7-9H2,1-2H3 |
InChIKey | GOXQRTZXKQZDDN-UHFFFAOYSA-N |
SMILES | CCCCC(CC)COC(=O)C=C |