For research use only. Not for therapeutic Use.
2-Ethylhexyl hexanoate (Cat.No:M087141) is an ester compound commonly used in the fragrance and flavor industry. It imparts a fruity and sweet aroma, making it a valuable ingredient in perfumes, cosmetics, and food products. Its versatile characteristics contribute to enhancing sensory experiences in various consumer goods.
CAS Number | 16397-75-4 |
Molecular Formula | C14H28O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2-ethylhexyl hexanoate |
InChI | InChI=1S/C14H28O2/c1-4-7-9-11-14(15)16-12-13(6-3)10-8-5-2/h13H,4-12H2,1-3H3 |
InChIKey | QRNFTMKPBPCPJO-UHFFFAOYSA-N |
SMILES | CCCCCC(=O)OCC(CC)CCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |