For research use only. Not for therapeutic Use.
2-Ethylhexyl valerate(CAT: L000028) is a chemical compound primarily used in the field of organic chemistry. This compound serves as a valuable reagent and intermediate for the synthesis of various organic compounds, enabling the diversification of chemical synthesis. Its specific structure provides opportunities for creating specialized molecules with potential uses in various areas within the field of organic chemistry.
CAS Number | 5451-87-6 |
Molecular Formula | C13H26O2 |
Purity | ≥95% |
IUPAC Name | 2-ethylhexyl pentanoate |
InChI | InChI=1S/C13H26O2/c1-4-7-9-12(6-3)11-15-13(14)10-8-5-2/h12H,4-11H2,1-3H3 |
InChIKey | FSJUXYZQJUNUBZ-UHFFFAOYSA-N |